About 1'-(2-methylpropyl)-5'-(piperidine-1-carbonyl)spiro[1,3-dioxane-2,3'-indole]-2'-one
1'-(2-methylpropyl)-5'-(piperidine-1-carbonyl)spiro[1,3-dioxane-2,3'-indole]-2'-one (PubChem CID 91475727) has the molecular formula C21H28N2O4
and a molecular weight of 372.47 g/mol. Its IUPAC name is 1'-(2-methylpropyl)-5'-(piperidine-1-carbonyl)spiro[1,3-dioxane-2,3'-indole]-2'-one.
Molecular Properties
| Compound Name | 1'-(2-methylpropyl)-5'-(piperidine-1-carbonyl)spiro[1,3-dioxane-2,3'-indole]-2'-one |
| PubChem CID | 91475727 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 1'-(2-methylpropyl)-5'-(piperidine-1-carbonyl)spiro[1,3-dioxane-2,3'-indole]-2'-one |
| SMILES | CC(C)CN1C(=O)C2(OCCCO2)c2cc(C(=O)N3CCCCC3)ccc21 |
| InChI | InChI=1S/C21H28N2O4/c1-15(2)14-23-18-8-7-16(19(24)22-9-4-3-5-10-22)13-17(18)21(20(23)25)26-11-6-12-27-21/h7-8,13,15H,3-6,9-12,14H2,1-2H3 |
| InChIKey | DOKXMUISBONPGL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1'-(2-methylpropyl)-5'-(piperidine-1-carbonyl)spiro[1,3-dioxane-2,3'-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-(2-methylpropyl)-5'-(piperidine-1-carbonyl)spiro[1,3-dioxane-2,3'-indole]-2'-one?
The IUPAC name of 1'-(2-methylpropyl)-5'-(piperidine-1-carbonyl)spiro[1,3-dioxane-2,3'-indole]-2'-one (CID 91475727) is 1'-(2-methylpropyl)-5'-(piperidine-1-carbonyl)spiro[1,3-dioxane-2,3'-indole]-2'-one.
What is the SMILES notation for 1'-(2-methylpropyl)-5'-(piperidine-1-carbonyl)spiro[1,3-dioxane-2,3'-indole]-2'-one?
The canonical SMILES for 1'-(2-methylpropyl)-5'-(piperidine-1-carbonyl)spiro[1,3-dioxane-2,3'-indole]-2'-one is CC(C)CN1C(=O)C2(OCCCO2)c2cc(C(=O)N3CCCCC3)ccc21.
What is the InChIKey of 1'-(2-methylpropyl)-5'-(piperidine-1-carbonyl)spiro[1,3-dioxane-2,3'-indole]-2'-one?
The InChIKey is DOKXMUISBONPGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28N2O4/c1-15(2)14-23-18-8-7-16(19(24)22-9-4-3-5-10-22)13-17(18)21(20(23)25)26-11-6-12-27-21/h7-8,13,15H,3-6,9-12,14H2,1-2H3.
What are the key properties of 1'-(2-methylpropyl)-5'-(piperidine-1-carbonyl)spiro[1,3-dioxane-2,3'-indole]-2'-one?
1'-(2-methylpropyl)-5'-(piperidine-1-carbonyl)spiro[1,3-dioxane-2,3'-indole]-2'-one has a molecular weight of 372.47 g/mol, XLogP of 2.90, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-(2-methylpropyl)-5'-(piperidine-1-carbonyl)spiro[1,3-dioxane-2,3'-indole]-2'-one is sourced from PubChem (CID 91475727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).