C23H29N3O4 — CID 46832981
6-[2'-oxo-5'-(piperidine-1-carbonyl)spiro[1,3-dioxane-2,3'-indole]-1'-yl]hexanenitrile (PubChem CID 46832981) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is 6-[2'-oxo-5'-(piperidine-1-carbonyl)spiro[1,3-dioxane-2,3'-indole]-1'-yl]hexanenitrile.
| Compound Name | 6-[2'-oxo-5'-(piperidine-1-carbonyl)spiro[1,3-dioxane-2,3'-indole]-1'-yl]hexanenitrile |
|---|---|
| PubChem CID | 46832981 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 6-[2'-oxo-5'-(piperidine-1-carbonyl)spiro[1,3-dioxane-2,3'-indole]-1'-yl]hexanenitrile |
| SMILES | N#CCCCCCN1C(=O)C2(OCCCO2)c2cc(C(=O)N3CCCCC3)ccc21 |
| InChI | InChI=1S/C23H29N3O4/c24-11-4-1-2-7-14-26-20-10-9-18(21(27)25-12-5-3-6-13-25)17-19(20)23(22(26)28)29-15-8-16-30-23/h9-10,17H,1-8,12-16H2 |
| InChIKey | HSIMBSNBPJVEQF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 82.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|