C19H23ClN6 — CID 91476034
6-N-(4-aminocyclohexyl)-8-N-(4-chloro-3-methylphenyl)imidazo[1,2-b]pyridazine-6,8-diamine (PubChem CID 91476034) has the molecular formula C19H23ClN6 and a molecular weight of 370.89 g/mol. Its IUPAC name is 6-N-(4-aminocyclohexyl)-8-N-(4-chloro-3-methylphenyl)imidazo[1,2-b]pyridazine-6,8-diamine.
| Compound Name | 6-N-(4-aminocyclohexyl)-8-N-(4-chloro-3-methylphenyl)imidazo[1,2-b]pyridazine-6,8-diamine |
|---|---|
| PubChem CID | 91476034 |
| Molecular Formula | C19H23ClN6 |
| Molecular Weight | 370.89 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 6-N-(4-aminocyclohexyl)-8-N-(4-chloro-3-methylphenyl)imidazo[1,2-b]pyridazine-6,8-diamine |
| SMILES | Cc1cc(Nc2cc(NC3CCC(N)CC3)nn3ccnc23)ccc1Cl |
| InChI | InChI=1S/C19H23ClN6/c1-12-10-15(6-7-16(12)20)23-17-11-18(25-26-9-8-22-19(17)26)24-14-4-2-13(21)3-5-14/h6-11,13-14,23H,2-5,21H2,1H3,(H,24,25) |
| InChIKey | GBXZEPVASCWLDS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.89 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|