C36H54O11S — CID 91479420
benzyl 2,2-dimethylbutanoate;(Z)-6-(2,2-dimethylbutanoyloxymethyl)-7-[3-(3-methoxy-2,2-dimethyl-3-oxopropyl)sulfanylpropanoyloxy]-4-oxohept-2-enoic acid (PubChem CID 91479420) has the molecular formula C36H54O11S and a molecular weight of 694.88 g/mol. Its IUPAC name is benzyl 2,2-dimethylbutanoate;(Z)-6-(2,2-dimethylbutanoyloxymethyl)-7-[3-(3-methoxy-2,2-dimethyl-3-oxopropyl)sulfanylpropanoyloxy]-4-oxohept-2-enoic acid.
| Compound Name | benzyl 2,2-dimethylbutanoate;(Z)-6-(2,2-dimethylbutanoyloxymethyl)-7-[3-(3-methoxy-2,2-dimethyl-3-oxopropyl)sulfanylpropanoyloxy]-4-oxohept-2-enoic acid |
|---|---|
| PubChem CID | 91479420 |
| Molecular Formula | C36H54O11S |
| Molecular Weight | 694.88 g/mol |
| Exact Mass | 694.34 |
| IUPAC Name | benzyl 2,2-dimethylbutanoate;(Z)-6-(2,2-dimethylbutanoyloxymethyl)-7-[3-(3-methoxy-2,2-dimethyl-3-oxopropyl)sulfanylpropanoyloxy]-4-oxohept-2-enoic acid |
| SMILES | CCC(C)(C)C(=O)OCC(COC(=O)CCSCC(C)(C)C(=O)OC)CC(=O)/C=C\C(=O)O.CCC(C)(C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H36O9S.C13H18O2/c1-7-22(2,3)21(29)32-14-16(12-17(24)8-9-18(25)26)13-31-19(27)10-11-33-15-23(4,5)20(28)30-6;1-4-13(2,3)12(14)15-10-11-8-6-5-7-9-11/h8-9,16H,7,10-15H2,1-6H3,(H,25,26);5-9H,4,10H2,1-3H3/b9-8-; |
| InChIKey | VNZBDFODUROYEB-UOQXYWCXSA-N |
| XLogP | 6.21 |
| TPSA | 159.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.88 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|