C6H14O9S2 — CID 91484008
1,2-dihydroxy-3-(3-hydroxypropoxysulfonylsulfonyloxy)propane (PubChem CID 91484008) has the molecular formula C6H14O9S2 and a molecular weight of 294.30 g/mol. Its IUPAC name is 1,2-dihydroxy-3-(3-hydroxypropoxysulfonylsulfonyloxy)propane.
| Compound Name | 1,2-dihydroxy-3-(3-hydroxypropoxysulfonylsulfonyloxy)propane |
|---|---|
| PubChem CID | 91484008 |
| Molecular Formula | C6H14O9S2 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | 1,2-dihydroxy-3-(3-hydroxypropoxysulfonylsulfonyloxy)propane |
| SMILES | O=S(=O)(OCCCO)S(=O)(=O)OCC(O)CO |
| InChI | InChI=1S/C6H14O9S2/c7-2-1-3-14-16(10,11)17(12,13)15-5-6(9)4-8/h6-9H,1-5H2 |
| InChIKey | BCMJKOHXBXHMFQ-UHFFFAOYSA-N |
| XLogP | -2.67 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|