C21H42O6S — CID 87905758
2,3-dihydroxypropyl [(Z)-octadec-9-enyl] sulfate (PubChem CID 87905758) has the molecular formula C21H42O6S and a molecular weight of 422.63 g/mol. Its IUPAC name is 2,3-dihydroxypropyl [(Z)-octadec-9-enyl] sulfate.
| Compound Name | 2,3-dihydroxypropyl [(Z)-octadec-9-enyl] sulfate |
|---|---|
| PubChem CID | 87905758 |
| Molecular Formula | C21H42O6S |
| Molecular Weight | 422.63 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | 2,3-dihydroxypropyl [(Z)-octadec-9-enyl] sulfate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOS(=O)(=O)OCC(O)CO |
| InChI | InChI=1S/C21H42O6S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-26-28(24,25)27-20-21(23)19-22/h9-10,21-23H,2-8,11-20H2,1H3/b10-9- |
| InChIKey | XNELOWKPPFYHJE-KTKRTIGZSA-N |
| XLogP | 4.66 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.63 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|