C17H14BrN3O3 — CID 9148582
[4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl] 5-bromofuran-2-carboxylate (PubChem CID 9148582) has the molecular formula C17H14BrN3O3 and a molecular weight of 388.22 g/mol. Its IUPAC name is [4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl] 5-bromofuran-2-carboxylate.
| Compound Name | [4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl] 5-bromofuran-2-carboxylate |
|---|---|
| PubChem CID | 9148582 |
| Molecular Formula | C17H14BrN3O3 |
| Molecular Weight | 388.22 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | [4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl] 5-bromofuran-2-carboxylate |
| SMILES | Cc1cc(C)nc(Nc2ccc(OC(=O)c3ccc(Br)o3)cc2)n1 |
| InChI | InChI=1S/C17H14BrN3O3/c1-10-9-11(2)20-17(19-10)21-12-3-5-13(6-4-12)23-16(22)14-7-8-15(18)24-14/h3-9H,1-2H3,(H,19,20,21) |
| InChIKey | SHLKZDRKRVJUIL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.22 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|