C15H23N5O2 — CID 91487531
4-[2-amino-4-methyl-6-(pentylamino)pyrimidin-5-yl]but-3-ynylcarbamic acid (PubChem CID 91487531) has the molecular formula C15H23N5O2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 4-[2-amino-4-methyl-6-(pentylamino)pyrimidin-5-yl]but-3-ynylcarbamic acid.
| Compound Name | 4-[2-amino-4-methyl-6-(pentylamino)pyrimidin-5-yl]but-3-ynylcarbamic acid |
|---|---|
| PubChem CID | 91487531 |
| Molecular Formula | C15H23N5O2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | 4-[2-amino-4-methyl-6-(pentylamino)pyrimidin-5-yl]but-3-ynylcarbamic acid |
| SMILES | CCCCCNc1nc(N)nc(C)c1C#CCCNC(=O)O |
| InChI | InChI=1S/C15H23N5O2/c1-3-4-6-9-17-13-12(11(2)19-14(16)20-13)8-5-7-10-18-15(21)22/h18H,3-4,6-7,9-10H2,1-2H3,(H,21,22)(H3,16,17,19,20) |
| InChIKey | YYELSUXIZJBJKC-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|