C14H24FO5P — CID 91491545
(3R)-3-(2-diethoxyphosphoryl-2-fluoroethenyl)-1,4-dioxaspiro[4.5]decane (PubChem CID 91491545) has the molecular formula C14H24FO5P and a molecular weight of 322.31 g/mol. Its IUPAC name is (3R)-3-(2-diethoxyphosphoryl-2-fluoroethenyl)-1,4-dioxaspiro[4.5]decane.
| Compound Name | (3R)-3-(2-diethoxyphosphoryl-2-fluoroethenyl)-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 91491545 |
| Molecular Formula | C14H24FO5P |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | (3R)-3-(2-diethoxyphosphoryl-2-fluoroethenyl)-1,4-dioxaspiro[4.5]decane |
| SMILES | CCOP(=O)(OCC)C(F)=C[C@@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C14H24FO5P/c1-3-18-21(16,19-4-2)13(15)10-12-11-17-14(20-12)8-6-5-7-9-14/h10,12H,3-9,11H2,1-2H3/t12-/m1/s1 |
| InChIKey | IVHSEISGVDJNOM-GFCCVEGCSA-N |
| XLogP | 4.14 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|