C27H25F3N4O4 — CID 91496237
N-[3-[3-[hydroxy(methoxy)methyl]-2H-indazol-6-yl]phenyl]-3-morpholin-4-yl-5-(trifluoromethyl)benzamide (PubChem CID 91496237) has the molecular formula C27H25F3N4O4 and a molecular weight of 526.52 g/mol. Its IUPAC name is N-[3-[3-[hydroxy(methoxy)methyl]-2H-indazol-6-yl]phenyl]-3-morpholin-4-yl-5-(trifluoromethyl)benzamide.
| Compound Name | N-[3-[3-[hydroxy(methoxy)methyl]-2H-indazol-6-yl]phenyl]-3-morpholin-4-yl-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 91496237 |
| Molecular Formula | C27H25F3N4O4 |
| Molecular Weight | 526.52 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | N-[3-[3-[hydroxy(methoxy)methyl]-2H-indazol-6-yl]phenyl]-3-morpholin-4-yl-5-(trifluoromethyl)benzamide |
| SMILES | COC(O)c1[nH]nc2cc(-c3cccc(NC(=O)c4cc(N5CCOCC5)cc(C(F)(F)F)c4)c3)ccc12 |
| InChI | InChI=1S/C27H25F3N4O4/c1-37-26(36)24-22-6-5-17(14-23(22)32-33-24)16-3-2-4-20(12-16)31-25(35)18-11-19(27(28,29)30)15-21(13-18)34-7-9-38-10-8-34/h2-6,11-15,26,36H,7-10H2,1H3,(H,31,35)(H,32,33) |
| InChIKey | NQFPUJRZFPMCFK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 99.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.52 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|