C16H34O2P+ — CID 91499752
3-methylheptan-3-yloxy-oxo-(2,4,4-trimethylpentyl)phosphanium (PubChem CID 91499752) has the molecular formula C16H34O2P+ and a molecular weight of 289.42 g/mol. Its IUPAC name is 3-methylheptan-3-yloxy-oxo-(2,4,4-trimethylpentyl)phosphanium.
| Compound Name | 3-methylheptan-3-yloxy-oxo-(2,4,4-trimethylpentyl)phosphanium |
|---|---|
| PubChem CID | 91499752 |
| Molecular Formula | C16H34O2P+ |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.23 |
| IUPAC Name | 3-methylheptan-3-yloxy-oxo-(2,4,4-trimethylpentyl)phosphanium |
| SMILES | CCCCC(C)(CC)O[P+](=O)CC(C)CC(C)(C)C |
| InChI | InChI=1S/C16H34O2P/c1-8-10-11-16(7,9-2)18-19(17)13-14(3)12-15(4,5)6/h14H,8-13H2,1-7H3/q+1 |
| InChIKey | SYNJFXYLTFIXLF-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|