About 3-methylheptan-3-yl(2,4,4-trimethylpentyl)phosphane
3-methylheptan-3-yl(2,4,4-trimethylpentyl)phosphane (PubChem CID 87632108) has the molecular formula C16H35P
and a molecular weight of 258.43 g/mol. Its IUPAC name is 3-methylheptan-3-yl(2,4,4-trimethylpentyl)phosphane.
Molecular Properties
| Compound Name | 3-methylheptan-3-yl(2,4,4-trimethylpentyl)phosphane |
| PubChem CID | 87632108 |
| Molecular Formula | C16H35P |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.25 |
| IUPAC Name | 3-methylheptan-3-yl(2,4,4-trimethylpentyl)phosphane |
| SMILES | CCCCC(C)(CC)PCC(C)CC(C)(C)C |
| InChI | InChI=1S/C16H35P/c1-8-10-11-16(7,9-2)17-13-14(3)12-15(4,5)6/h14,17H,8-13H2,1-7H3 |
| InChIKey | RGHZZHRIIPYHHA-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-methylheptan-3-yl(2,4,4-trimethylpentyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylheptan-3-yl(2,4,4-trimethylpentyl)phosphane?
The IUPAC name of 3-methylheptan-3-yl(2,4,4-trimethylpentyl)phosphane (CID 87632108) is 3-methylheptan-3-yl(2,4,4-trimethylpentyl)phosphane.
What is the SMILES notation for 3-methylheptan-3-yl(2,4,4-trimethylpentyl)phosphane?
The canonical SMILES for 3-methylheptan-3-yl(2,4,4-trimethylpentyl)phosphane is CCCCC(C)(CC)PCC(C)CC(C)(C)C.
What is the InChIKey of 3-methylheptan-3-yl(2,4,4-trimethylpentyl)phosphane?
The InChIKey is RGHZZHRIIPYHHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H35P/c1-8-10-11-16(7,9-2)17-13-14(3)12-15(4,5)6/h14,17H,8-13H2,1-7H3.
What are the key properties of 3-methylheptan-3-yl(2,4,4-trimethylpentyl)phosphane?
3-methylheptan-3-yl(2,4,4-trimethylpentyl)phosphane has a molecular weight of 258.43 g/mol, XLogP of 6.10, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylheptan-3-yl(2,4,4-trimethylpentyl)phosphane is sourced from PubChem (CID 87632108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).