C17H17ClO7 — CID 91500671
6-chloro-16,18-dihydroxy-3-oxabicyclo[12.4.0]octadeca-1(14),15,17-triene-2,8,9,10-tetrone (PubChem CID 91500671) has the molecular formula C17H17ClO7 and a molecular weight of 368.77 g/mol. Its IUPAC name is 6-chloro-16,18-dihydroxy-3-oxabicyclo[12.4.0]octadeca-1(14),15,17-triene-2,8,9,10-tetrone.
| Compound Name | 6-chloro-16,18-dihydroxy-3-oxabicyclo[12.4.0]octadeca-1(14),15,17-triene-2,8,9,10-tetrone |
|---|---|
| PubChem CID | 91500671 |
| Molecular Formula | C17H17ClO7 |
| Molecular Weight | 368.77 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 6-chloro-16,18-dihydroxy-3-oxabicyclo[12.4.0]octadeca-1(14),15,17-triene-2,8,9,10-tetrone |
| SMILES | O=C1CCCc2cc(O)cc(O)c2C(=O)OCCC(Cl)CC(=O)C1=O |
| InChI | InChI=1S/C17H17ClO7/c18-10-4-5-25-17(24)15-9(6-11(19)8-13(15)21)2-1-3-12(20)16(23)14(22)7-10/h6,8,10,19,21H,1-5,7H2 |
| InChIKey | YMCIHBVZLFTNDR-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.77 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|