C19H23NO6 — CID 91326978
(5R)-18-hydroxy-5-methyl-16-(methylamino)-3-oxabicyclo[12.4.0]octadeca-1(14),15,17-triene-2,8,9,10-tetrone (PubChem CID 91326978) has the molecular formula C19H23NO6 and a molecular weight of 361.39 g/mol. Its IUPAC name is (5R)-18-hydroxy-5-methyl-16-(methylamino)-3-oxabicyclo[12.4.0]octadeca-1(14),15,17-triene-2,8,9,10-tetrone.
| Compound Name | (5R)-18-hydroxy-5-methyl-16-(methylamino)-3-oxabicyclo[12.4.0]octadeca-1(14),15,17-triene-2,8,9,10-tetrone |
|---|---|
| PubChem CID | 91326978 |
| Molecular Formula | C19H23NO6 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | (5R)-18-hydroxy-5-methyl-16-(methylamino)-3-oxabicyclo[12.4.0]octadeca-1(14),15,17-triene-2,8,9,10-tetrone |
| SMILES | CNc1cc(O)c2c(c1)CCCC(=O)C(=O)C(=O)CC[C@@H](C)COC2=O |
| InChI | InChI=1S/C19H23NO6/c1-11-6-7-15(22)18(24)14(21)5-3-4-12-8-13(20-2)9-16(23)17(12)19(25)26-10-11/h8-9,11,20,23H,3-7,10H2,1-2H3/t11-/m1/s1 |
| InChIKey | UEEAXHPIAICJLM-LLVKDONJSA-N |
| XLogP | 2.05 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|