C25H23ClFN6O2+ — CID 91504412
[(1-amino-2-methoxyethylidene)amino]-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]-methylideneazanium (PubChem CID 91504412) has the molecular formula C25H23ClFN6O2+ and a molecular weight of 493.95 g/mol. Its IUPAC name is [(1-amino-2-methoxyethylidene)amino]-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]-methylideneazanium.
| Compound Name | [(1-amino-2-methoxyethylidene)amino]-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]-methylideneazanium |
|---|---|
| PubChem CID | 91504412 |
| Molecular Formula | C25H23ClFN6O2+ |
| Molecular Weight | 493.95 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | [(1-amino-2-methoxyethylidene)amino]-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]-methylideneazanium |
| SMILES | C=[N+](N=C(N)COC)c1ccc2ncnc(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C25H23ClFN6O2/c1-33(32-24(28)14-34-2)19-7-8-22-20(12-19)25(30-15-29-22)31-18-6-9-23(21(26)11-18)35-13-16-4-3-5-17(27)10-16/h3-12,15H,1,13-14H2,2H3,(H2,28,32)(H,29,30,31)/q+1 |
| InChIKey | RCXNNHVUCZMUDR-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.95 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|