C18H27N3O11 — CID 91505103
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-2-[2-(2-azidoethoxy)ethyl]-6-hydroxyoxan-2-yl]methyl acetate (PubChem CID 91505103) has the molecular formula C18H27N3O11 and a molecular weight of 461.42 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-2-[2-(2-azidoethoxy)ethyl]-6-hydroxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-2-[2-(2-azidoethoxy)ethyl]-6-hydroxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 91505103 |
| Molecular Formula | C18H27N3O11 |
| Molecular Weight | 461.42 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-2-[2-(2-azidoethoxy)ethyl]-6-hydroxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@]1(CCOCCN=[N+]=[N-])O[C@@H](O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H27N3O11/c1-10(22)28-9-18(5-7-27-8-6-20-21-19)16(31-13(4)25)14(29-11(2)23)15(17(26)32-18)30-12(3)24/h14-17,26H,5-9H2,1-4H3/t14-,15-,16-,17-,18-/m1/s1 |
| InChIKey | ANNAZMCTDKSEOD-DUQPFJRNSA-N |
| XLogP | 0.15 |
| TPSA | 192.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.42 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|