C29H52O13Si — CID 163263260
[(2R,3S,4R)-3,4,5-triacetyloxy-2-[2-[2-[2-tri(propan-2-yl)silyloxyethoxy]ethoxy]ethoxymethyl]oxolan-2-yl]methyl acetate (PubChem CID 163263260) has the molecular formula C29H52O13Si and a molecular weight of 636.81 g/mol. Its IUPAC name is [(2R,3S,4R)-3,4,5-triacetyloxy-2-[2-[2-[2-tri(propan-2-yl)silyloxyethoxy]ethoxy]ethoxymethyl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R)-3,4,5-triacetyloxy-2-[2-[2-[2-tri(propan-2-yl)silyloxyethoxy]ethoxy]ethoxymethyl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 163263260 |
| Molecular Formula | C29H52O13Si |
| Molecular Weight | 636.81 g/mol |
| Exact Mass | 636.32 |
| IUPAC Name | [(2R,3S,4R)-3,4,5-triacetyloxy-2-[2-[2-[2-tri(propan-2-yl)silyloxyethoxy]ethoxy]ethoxymethyl]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@]1(COCCOCCOCCO[Si](C(C)C)(C(C)C)C(C)C)OC(OC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C29H52O13Si/c1-19(2)43(20(3)4,21(5)6)38-16-15-35-12-11-34-13-14-36-17-29(18-37-22(7)30)27(40-24(9)32)26(39-23(8)31)28(42-29)41-25(10)33/h19-21,26-28H,11-18H2,1-10H3/t26-,27+,28?,29-/m1/s1 |
| InChIKey | MSEKFRMJQAPMKR-WAAVWZAJSA-N |
| XLogP | 3.31 |
| TPSA | 151.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.81 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|