C25H30Cl2N2O3 — CID 91506872
tert-butyl (5aR,10bR)-9,10-dichloro-6-(2-phenoxyethyl)-1,2,4,5,5a,10b-hexahydroazepino[4,5-b]indole-3-carboxylate (PubChem CID 91506872) has the molecular formula C25H30Cl2N2O3 and a molecular weight of 477.43 g/mol. Its IUPAC name is tert-butyl (5aR,10bR)-9,10-dichloro-6-(2-phenoxyethyl)-1,2,4,5,5a,10b-hexahydroazepino[4,5-b]indole-3-carboxylate.
| Compound Name | tert-butyl (5aR,10bR)-9,10-dichloro-6-(2-phenoxyethyl)-1,2,4,5,5a,10b-hexahydroazepino[4,5-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 91506872 |
| Molecular Formula | C25H30Cl2N2O3 |
| Molecular Weight | 477.43 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | tert-butyl (5aR,10bR)-9,10-dichloro-6-(2-phenoxyethyl)-1,2,4,5,5a,10b-hexahydroazepino[4,5-b]indole-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]2c3c(ccc(Cl)c3Cl)N(CCOc3ccccc3)[C@@H]2CC1 |
| InChI | InChI=1S/C25H30Cl2N2O3/c1-25(2,3)32-24(30)28-13-11-18-20(12-14-28)29(15-16-31-17-7-5-4-6-8-17)21-10-9-19(26)23(27)22(18)21/h4-10,18,20H,11-16H2,1-3H3/t18-,20+/m0/s1 |
| InChIKey | OEADZXDTHVBGMU-AZUAARDMSA-N |
| XLogP | 6.38 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.43 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |