C16H16N2O2 — CID 91515506
(4,5-diphenyl-4,5-dihydro-1H-imidazol-2-yl)methanediol (PubChem CID 91515506) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is (4,5-diphenyl-4,5-dihydro-1H-imidazol-2-yl)methanediol.
| Compound Name | (4,5-diphenyl-4,5-dihydro-1H-imidazol-2-yl)methanediol |
|---|---|
| PubChem CID | 91515506 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | (4,5-diphenyl-4,5-dihydro-1H-imidazol-2-yl)methanediol |
| SMILES | OC(O)C1=NC(c2ccccc2)C(c2ccccc2)N1 |
| InChI | InChI=1S/C16H16N2O2/c19-16(20)15-17-13(11-7-3-1-4-8-11)14(18-15)12-9-5-2-6-10-12/h1-10,13-14,16,19-20H,(H,17,18) |
| InChIKey | YZTQMMHIZADKPG-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|