C24H45NO4 — CID 91520523
N-(2,3-dihydroxypropyl)-2-hydroxy-N-octadeca-9,12-dienylpropanamide (PubChem CID 91520523) has the molecular formula C24H45NO4 and a molecular weight of 411.63 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-2-hydroxy-N-octadeca-9,12-dienylpropanamide.
| Compound Name | N-(2,3-dihydroxypropyl)-2-hydroxy-N-octadeca-9,12-dienylpropanamide |
|---|---|
| PubChem CID | 91520523 |
| Molecular Formula | C24H45NO4 |
| Molecular Weight | 411.63 g/mol |
| Exact Mass | 411.33 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-2-hydroxy-N-octadeca-9,12-dienylpropanamide |
| SMILES | CCCCCC=CCC=CCCCCCCCCN(CC(O)CO)C(=O)C(C)O |
| InChI | InChI=1S/C24H45NO4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-25(20-23(28)21-26)24(29)22(2)27/h7-8,10-11,22-23,26-28H,3-6,9,12-21H2,1-2H3 |
| InChIKey | TZPSXKDAVGHVFI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.63 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|