About ethane;3-methyl-4-prop-1-en-2-yl-1,3,4-oxadiazolidine
ethane;3-methyl-4-prop-1-en-2-yl-1,3,4-oxadiazolidine (PubChem CID 91520593) has the molecular formula C8H18N2O
and a molecular weight of 158.24 g/mol. Its IUPAC name is ethane;3-methyl-4-prop-1-en-2-yl-1,3,4-oxadiazolidine.
Analyze ethane;3-methyl-4-prop-1-en-2-yl-1,3,4-oxadiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methyl-4-prop-1-en-2-yl-1,3,4-oxadiazolidine?
The IUPAC name of ethane;3-methyl-4-prop-1-en-2-yl-1,3,4-oxadiazolidine (CID 91520593) is ethane;3-methyl-4-prop-1-en-2-yl-1,3,4-oxadiazolidine.
What is the SMILES notation for ethane;3-methyl-4-prop-1-en-2-yl-1,3,4-oxadiazolidine?
The canonical SMILES for ethane;3-methyl-4-prop-1-en-2-yl-1,3,4-oxadiazolidine is C=C(C)N1COCN1C.CC.
What is the InChIKey of ethane;3-methyl-4-prop-1-en-2-yl-1,3,4-oxadiazolidine?
The InChIKey is AXFFPVMHXKRGMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O.C2H6/c1-6(2)8-5-9-4-7(8)3;1-2/h1,4-5H2,2-3H3;1-2H3.
What are the key properties of ethane;3-methyl-4-prop-1-en-2-yl-1,3,4-oxadiazolidine?
ethane;3-methyl-4-prop-1-en-2-yl-1,3,4-oxadiazolidine has a molecular weight of 158.24 g/mol, XLogP of 1.64, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methyl-4-prop-1-en-2-yl-1,3,4-oxadiazolidine is sourced from PubChem (CID 91520593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).