C17H17ClF2O3S — CID 91524933
1-(4-chlorophenyl)sulfonyl-1-(2,5-difluorophenyl)pentan-1-ol (PubChem CID 91524933) has the molecular formula C17H17ClF2O3S and a molecular weight of 374.84 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-1-(2,5-difluorophenyl)pentan-1-ol.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-1-(2,5-difluorophenyl)pentan-1-ol |
|---|---|
| PubChem CID | 91524933 |
| Molecular Formula | C17H17ClF2O3S |
| Molecular Weight | 374.84 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-1-(2,5-difluorophenyl)pentan-1-ol |
| SMILES | CCCCC(O)(c1cc(F)ccc1F)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H17ClF2O3S/c1-2-3-10-17(21,15-11-13(19)6-9-16(15)20)24(22,23)14-7-4-12(18)5-8-14/h4-9,11,21H,2-3,10H2,1H3 |
| InChIKey | LWKWRQGLIBPBHJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.84 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |