C22H26O2 — CID 91526577
1-phenyl-6-(4-propanoylcyclohex-3-en-1-yl)hepta-1,6-dien-3-one (PubChem CID 91526577) has the molecular formula C22H26O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is 1-phenyl-6-(4-propanoylcyclohex-3-en-1-yl)hepta-1,6-dien-3-one.
| Compound Name | 1-phenyl-6-(4-propanoylcyclohex-3-en-1-yl)hepta-1,6-dien-3-one |
|---|---|
| PubChem CID | 91526577 |
| Molecular Formula | C22H26O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 1-phenyl-6-(4-propanoylcyclohex-3-en-1-yl)hepta-1,6-dien-3-one |
| SMILES | C=C(CCC(=O)C=Cc1ccccc1)C1CC=C(C(=O)CC)CC1 |
| InChI | InChI=1S/C22H26O2/c1-3-22(24)20-13-11-19(12-14-20)17(2)9-15-21(23)16-10-18-7-5-4-6-8-18/h4-8,10,13,16,19H,2-3,9,11-12,14-15H2,1H3 |
| InChIKey | IEUCRIQKLCTCSP-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|