About imidazo[5,1-b]quinazoline
imidazo[5,1-b]quinazoline (PubChem CID 91528922) has the molecular formula C10H7N3
and a molecular weight of 169.19 g/mol. Its IUPAC name is imidazo[5,1-b]quinazoline.
Molecular Properties
| Compound Name | imidazo[5,1-b]quinazoline |
| PubChem CID | 91528922 |
| Molecular Formula | C10H7N3 |
| Molecular Weight | 169.19 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | imidazo[5,1-b]quinazoline |
| SMILES | c1ccc2nc3cncn3cc2c1 |
| InChI | InChI=1S/C10H7N3/c1-2-4-9-8(3-1)6-13-7-11-5-10(13)12-9/h1-7H |
| InChIKey | UFHLXZLNVUISCP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.19 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze imidazo[5,1-b]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[5,1-b]quinazoline?
The IUPAC name of imidazo[5,1-b]quinazoline (CID 91528922) is imidazo[5,1-b]quinazoline.
What is the SMILES notation for imidazo[5,1-b]quinazoline?
The canonical SMILES for imidazo[5,1-b]quinazoline is c1ccc2nc3cncn3cc2c1.
What is the InChIKey of imidazo[5,1-b]quinazoline?
The InChIKey is UFHLXZLNVUISCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N3/c1-2-4-9-8(3-1)6-13-7-11-5-10(13)12-9/h1-7H.
What are the key properties of imidazo[5,1-b]quinazoline?
imidazo[5,1-b]quinazoline has a molecular weight of 169.19 g/mol, XLogP of 1.88, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[5,1-b]quinazoline is sourced from PubChem (CID 91528922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).