C11H16O5 — CID 91536351
2-(2-hydroxypropyl)-5-prop-2-enoyloxypent-2-enoic acid (PubChem CID 91536351) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is 2-(2-hydroxypropyl)-5-prop-2-enoyloxypent-2-enoic acid.
| Compound Name | 2-(2-hydroxypropyl)-5-prop-2-enoyloxypent-2-enoic acid |
|---|---|
| PubChem CID | 91536351 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 2-(2-hydroxypropyl)-5-prop-2-enoyloxypent-2-enoic acid |
| SMILES | C=CC(=O)OCCC=C(CC(C)O)C(=O)O |
| InChI | InChI=1S/C11H16O5/c1-3-10(13)16-6-4-5-9(11(14)15)7-8(2)12/h3,5,8,12H,1,4,6-7H2,2H3,(H,14,15) |
| InChIKey | LEOPJQLVUXSXBT-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|