C24H31F3N6O5S — CID 91537453
2-N-[[4-(3-methylsulfonylpyrrolidin-1-yl)cyclohexyl]methyl]-5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-diamine (PubChem CID 91537453) has the molecular formula C24H31F3N6O5S and a molecular weight of 572.61 g/mol. Its IUPAC name is 2-N-[[4-(3-methylsulfonylpyrrolidin-1-yl)cyclohexyl]methyl]-5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-diamine.
| Compound Name | 2-N-[[4-(3-methylsulfonylpyrrolidin-1-yl)cyclohexyl]methyl]-5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 91537453 |
| Molecular Formula | C24H31F3N6O5S |
| Molecular Weight | 572.61 g/mol |
| Exact Mass | 572.20 |
| IUPAC Name | 2-N-[[4-(3-methylsulfonylpyrrolidin-1-yl)cyclohexyl]methyl]-5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-diamine |
| SMILES | CS(=O)(=O)C1CCN(C2CCC(CN(Cc3ccccc3OC(F)(F)F)c3ncc([N+](=O)[O-])c(N)n3)CC2)C1 |
| InChI | InChI=1S/C24H31F3N6O5S/c1-39(36,37)19-10-11-31(15-19)18-8-6-16(7-9-18)13-32(23-29-12-20(33(34)35)22(28)30-23)14-17-4-2-3-5-21(17)38-24(25,26)27/h2-5,12,16,18-19H,6-11,13-15H2,1H3,(H2,28,29,30) |
| InChIKey | LJZXFJAFFCYEAT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 144.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.61 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|