C18H34 — CID 91538914
6-ethenyl-7-ethyl-5,8-dimethyldodec-4-ene (PubChem CID 91538914) has the molecular formula C18H34 and a molecular weight of 250.47 g/mol. Its IUPAC name is 6-ethenyl-7-ethyl-5,8-dimethyldodec-4-ene.
| Compound Name | 6-ethenyl-7-ethyl-5,8-dimethyldodec-4-ene |
|---|---|
| PubChem CID | 91538914 |
| Molecular Formula | C18H34 |
| Molecular Weight | 250.47 g/mol |
| Exact Mass | 250.27 |
| IUPAC Name | 6-ethenyl-7-ethyl-5,8-dimethyldodec-4-ene |
| SMILES | C=CC(C(C)=CCCC)C(CC)C(C)CCCC |
| InChI | InChI=1S/C18H34/c1-7-11-13-15(5)17(9-3)18(10-4)16(6)14-12-8-2/h9,13,16-18H,3,7-8,10-12,14H2,1-2,4-6H3 |
| InChIKey | CEGVASNPNLUIOU-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.47 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|