C47H62BrF2O8S3+ — CID 91541503
[2-[9-(4-bromophenyl)sulfonyloxynonoxy]-1,1-difluoro-2-oxoethyl]sulfonyl-[tris(4-tert-butylphenyl)-λ4-sulfanyl]oxidanium (PubChem CID 91541503) has the molecular formula C47H62BrF2O8S3+ and a molecular weight of 969.11 g/mol. Its IUPAC name is [2-[9-(4-bromophenyl)sulfonyloxynonoxy]-1,1-difluoro-2-oxoethyl]sulfonyl-[tris(4-tert-butylphenyl)-λ4-sulfanyl]oxidanium.
| Compound Name | [2-[9-(4-bromophenyl)sulfonyloxynonoxy]-1,1-difluoro-2-oxoethyl]sulfonyl-[tris(4-tert-butylphenyl)-λ4-sulfanyl]oxidanium |
|---|---|
| PubChem CID | 91541503 |
| Molecular Formula | C47H62BrF2O8S3+ |
| Molecular Weight | 969.11 g/mol |
| Exact Mass | 967.28 |
| IUPAC Name | [2-[9-(4-bromophenyl)sulfonyloxynonoxy]-1,1-difluoro-2-oxoethyl]sulfonyl-[tris(4-tert-butylphenyl)-λ4-sulfanyl]oxidanium |
| SMILES | CC(C)(C)c1ccc(S([OH+]S(=O)(=O)C(F)(F)C(=O)OCCCCCCCCCOS(=O)(=O)c2ccc(Br)cc2)(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C47H61BrF2O8S3/c1-44(2,3)35-17-25-39(26-18-35)59(40-27-19-36(20-28-40)45(4,5)6,41-29-21-37(22-30-41)46(7,8)9)58-61(54,55)47(49,50)43(51)56-33-15-13-11-10-12-14-16-34-57-60(52,53)42-31-23-38(48)24-32-42/h17-32H,10-16,33-34H2,1-9H3/p+1 |
| InChIKey | XDCVMDZVHBFAOT-UHFFFAOYSA-O |
| XLogP | 13.23 |
| TPSA | 116.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 969.11 |
| LogP ≤ 5 | 13.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|