C11H10N2 — CID 91543244
5,6-dihydropyrrolo[1,2-h][1,7]naphthyridine (PubChem CID 91543244) has the molecular formula C11H10N2 and a molecular weight of 170.22 g/mol. Its IUPAC name is 5,6-dihydropyrrolo[1,2-h][1,7]naphthyridine.
| Compound Name | 5,6-dihydropyrrolo[1,2-h][1,7]naphthyridine |
|---|---|
| PubChem CID | 91543244 |
| Molecular Formula | C11H10N2 |
| Molecular Weight | 170.22 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 5,6-dihydropyrrolo[1,2-h][1,7]naphthyridine |
| SMILES | c1cnc2c(c1)CCn1cccc1-2 |
| InChI | InChI=1S/C11H10N2/c1-3-9-5-8-13-7-2-4-10(13)11(9)12-6-1/h1-4,6-7H,5,8H2 |
| InChIKey | NFPWPTYOFAITTQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |