C15H23NO — CID 91547178
6-(2-ethenylbut-2-enoxy)-N,N-dimethylhepta-2,4,6-trien-3-amine (PubChem CID 91547178) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is 6-(2-ethenylbut-2-enoxy)-N,N-dimethylhepta-2,4,6-trien-3-amine.
| Compound Name | 6-(2-ethenylbut-2-enoxy)-N,N-dimethylhepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 91547178 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 6-(2-ethenylbut-2-enoxy)-N,N-dimethylhepta-2,4,6-trien-3-amine |
| SMILES | C=CC(=CC)COC(=C)C=CC(=CC)N(C)C |
| InChI | InChI=1S/C15H23NO/c1-7-14(8-2)12-17-13(4)10-11-15(9-3)16(5)6/h7-11H,1,4,12H2,2-3,5-6H3 |
| InChIKey | LEZBVFPCYFQICV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|