C11H17NO — CID 142026809
(3E)-4-ethenyl-5-propoxyhexa-1,3,5-trien-2-amine (PubChem CID 142026809) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is (3E)-4-ethenyl-5-propoxyhexa-1,3,5-trien-2-amine.
| Compound Name | (3E)-4-ethenyl-5-propoxyhexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 142026809 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (3E)-4-ethenyl-5-propoxyhexa-1,3,5-trien-2-amine |
| SMILES | C=C/C(=C\C(=C)N)C(=C)OCCC |
| InChI | InChI=1S/C11H17NO/c1-5-7-13-10(4)11(6-2)8-9(3)12/h6,8H,2-5,7,12H2,1H3/b11-8+ |
| InChIKey | JDQWRRPIZKNZFL-DHZHZOJOSA-N |
| XLogP | 2.51 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|