C12H19NOS — CID 130374425
N-[(3E,5E)-2,6-dimethyl-7-prop-1-en-2-yloxyhepta-1,3,5-trien-3-yl]thiohydroxylamine (PubChem CID 130374425) has the molecular formula C12H19NOS and a molecular weight of 225.36 g/mol. Its IUPAC name is N-[(3E,5E)-2,6-dimethyl-7-prop-1-en-2-yloxyhepta-1,3,5-trien-3-yl]thiohydroxylamine.
| Compound Name | N-[(3E,5E)-2,6-dimethyl-7-prop-1-en-2-yloxyhepta-1,3,5-trien-3-yl]thiohydroxylamine |
|---|---|
| PubChem CID | 130374425 |
| Molecular Formula | C12H19NOS |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | N-[(3E,5E)-2,6-dimethyl-7-prop-1-en-2-yloxyhepta-1,3,5-trien-3-yl]thiohydroxylamine |
| SMILES | C=C(C)OC/C(C)=C/C=C(/NS)C(=C)C |
| InChI | InChI=1S/C12H19NOS/c1-9(2)12(13-15)7-6-11(5)8-14-10(3)4/h6-7,13,15H,1,3,8H2,2,4-5H3/b11-6+,12-7+ |
| InChIKey | IKYWQDJSXXNOFM-GNXRPPCSSA-N |
| XLogP | 3.38 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|