C24H28N2O6S — CID 91552073
methyl 2-[3-(3,4-dimethoxyphenyl)prop-2-enoylamino]-3-[(2-methyl-2-sulfanylpropyl)carbamoyl]benzoate (PubChem CID 91552073) has the molecular formula C24H28N2O6S and a molecular weight of 472.56 g/mol. Its IUPAC name is methyl 2-[3-(3,4-dimethoxyphenyl)prop-2-enoylamino]-3-[(2-methyl-2-sulfanylpropyl)carbamoyl]benzoate.
| Compound Name | methyl 2-[3-(3,4-dimethoxyphenyl)prop-2-enoylamino]-3-[(2-methyl-2-sulfanylpropyl)carbamoyl]benzoate |
|---|---|
| PubChem CID | 91552073 |
| Molecular Formula | C24H28N2O6S |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | methyl 2-[3-(3,4-dimethoxyphenyl)prop-2-enoylamino]-3-[(2-methyl-2-sulfanylpropyl)carbamoyl]benzoate |
| SMILES | COC(=O)c1cccc(C(=O)NCC(C)(C)S)c1NC(=O)C=Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C24H28N2O6S/c1-24(2,33)14-25-22(28)16-7-6-8-17(23(29)32-5)21(16)26-20(27)12-10-15-9-11-18(30-3)19(13-15)31-4/h6-13,33H,14H2,1-5H3,(H,25,28)(H,26,27) |
| InChIKey | GVJZZPDASFJFKQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|