C25H29NO7S — CID 87875386
[2-(3-methyl-3-sulfanylbutoxy)-2-oxoethyl] 2-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]benzoate (PubChem CID 87875386) has the molecular formula C25H29NO7S and a molecular weight of 487.57 g/mol. Its IUPAC name is [2-(3-methyl-3-sulfanylbutoxy)-2-oxoethyl] 2-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]benzoate.
| Compound Name | [2-(3-methyl-3-sulfanylbutoxy)-2-oxoethyl] 2-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 87875386 |
| Molecular Formula | C25H29NO7S |
| Molecular Weight | 487.57 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | [2-(3-methyl-3-sulfanylbutoxy)-2-oxoethyl] 2-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]benzoate |
| SMILES | COc1ccc(/C=C/C(=O)Nc2ccccc2C(=O)OCC(=O)OCCC(C)(C)S)cc1OC |
| InChI | InChI=1S/C25H29NO7S/c1-25(2,34)13-14-32-23(28)16-33-24(29)18-7-5-6-8-19(18)26-22(27)12-10-17-9-11-20(30-3)21(15-17)31-4/h5-12,15,34H,13-14,16H2,1-4H3,(H,26,27)/b12-10+ |
| InChIKey | LHVFHBDRZALMGJ-ZRDIBKRKSA-N |
| XLogP | 4.15 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.57 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|