C26H27N5O3 — CID 91555448
3-(1-benzyl-2-oxoazepan-3-yl)imino-2-isocyano-3-[(2-methyl-1-benzofuran-5-yl)amino]propanamide (PubChem CID 91555448) has the molecular formula C26H27N5O3 and a molecular weight of 457.53 g/mol. Its IUPAC name is 3-(1-benzyl-2-oxoazepan-3-yl)imino-2-isocyano-3-[(2-methyl-1-benzofuran-5-yl)amino]propanamide.
| Compound Name | 3-(1-benzyl-2-oxoazepan-3-yl)imino-2-isocyano-3-[(2-methyl-1-benzofuran-5-yl)amino]propanamide |
|---|---|
| PubChem CID | 91555448 |
| Molecular Formula | C26H27N5O3 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 3-(1-benzyl-2-oxoazepan-3-yl)imino-2-isocyano-3-[(2-methyl-1-benzofuran-5-yl)amino]propanamide |
| SMILES | [C-]#[N+]C(C(N)=O)/C(=N\C1CCCCN(Cc2ccccc2)C1=O)Nc1ccc2oc(C)cc2c1 |
| InChI | InChI=1S/C26H27N5O3/c1-17-14-19-15-20(11-12-22(19)34-17)29-25(23(28-2)24(27)32)30-21-10-6-7-13-31(26(21)33)16-18-8-4-3-5-9-18/h3-5,8-9,11-12,14-15,21,23H,6-7,10,13,16H2,1H3,(H2,27,32)(H,29,30) |
| InChIKey | NKDTUCAMJSLVCX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 105.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|