C22H31B — CID 91561188
8,8-dimethyl-1-boratetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17)-hexaene;ethane (PubChem CID 91561188) has the molecular formula C22H31B and a molecular weight of 306.30 g/mol. Its IUPAC name is 8,8-dimethyl-1-boratetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17)-hexaene;ethane.
| Compound Name | 8,8-dimethyl-1-boratetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17)-hexaene;ethane |
|---|---|
| PubChem CID | 91561188 |
| Molecular Formula | C22H31B |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.25 |
| IUPAC Name | 8,8-dimethyl-1-boratetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17)-hexaene;ethane |
| SMILES | CC.CC.CC1(C)c2ccccc2B2CCCc3cccc1c32 |
| InChI | InChI=1S/C18H19B.2C2H6/c1-18(2)14-9-3-4-11-16(14)19-12-6-8-13-7-5-10-15(18)17(13)19;2*1-2/h3-5,7,9-11H,6,8,12H2,1-2H3;2*1-2H3 |
| InChIKey | PRYNRWAIVBZPCC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|