C11H15B — CID 142078378
1-methyl-2,3,4,5-tetrahydro-1-benzoborepine (PubChem CID 142078378) has the molecular formula C11H15B and a molecular weight of 158.05 g/mol. Its IUPAC name is 1-methyl-2,3,4,5-tetrahydro-1-benzoborepine.
| Compound Name | 1-methyl-2,3,4,5-tetrahydro-1-benzoborepine |
|---|---|
| PubChem CID | 142078378 |
| Molecular Formula | C11H15B |
| Molecular Weight | 158.05 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | 1-methyl-2,3,4,5-tetrahydro-1-benzoborepine |
| SMILES | CB1CCCCc2ccccc21 |
| InChI | InChI=1S/C11H15B/c1-12-9-5-4-7-10-6-2-3-8-11(10)12/h2-3,6,8H,4-5,7,9H2,1H3 |
| InChIKey | PPYUBRKSCVEONC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.05 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|