About [3-acetyloxy-2-(1,3-dimethyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenyl] acetate
[3-acetyloxy-2-(1,3-dimethyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenyl] acetate (PubChem CID 91563625) has the molecular formula C26H36O4
and a molecular weight of 412.57 g/mol. Its IUPAC name is [3-acetyloxy-2-(1,3-dimethyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenyl] acetate.
Molecular Properties
| Compound Name | [3-acetyloxy-2-(1,3-dimethyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenyl] acetate |
| PubChem CID | 91563625 |
| Molecular Formula | C26H36O4 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | [3-acetyloxy-2-(1,3-dimethyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenyl] acetate |
| SMILES | C=C(C)C1CCC(C)=CC1(C)c1c(OC(C)=O)cc(CCCCC)cc1OC(C)=O |
| InChI | InChI=1S/C26H36O4/c1-8-9-10-11-21-14-23(29-19(5)27)25(24(15-21)30-20(6)28)26(7)16-18(4)12-13-22(26)17(2)3/h14-16,22H,2,8-13H2,1,3-7H3 |
| InChIKey | WRLIAUBYZAJTOA-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-acetyloxy-2-(1,3-dimethyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-acetyloxy-2-(1,3-dimethyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenyl] acetate?
The IUPAC name of [3-acetyloxy-2-(1,3-dimethyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenyl] acetate (CID 91563625) is [3-acetyloxy-2-(1,3-dimethyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenyl] acetate.
What is the SMILES notation for [3-acetyloxy-2-(1,3-dimethyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenyl] acetate?
The canonical SMILES for [3-acetyloxy-2-(1,3-dimethyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenyl] acetate is C=C(C)C1CCC(C)=CC1(C)c1c(OC(C)=O)cc(CCCCC)cc1OC(C)=O.
What is the InChIKey of [3-acetyloxy-2-(1,3-dimethyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenyl] acetate?
The InChIKey is WRLIAUBYZAJTOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H36O4/c1-8-9-10-11-21-14-23(29-19(5)27)25(24(15-21)30-20(6)28)26(7)16-18(4)12-13-22(26)17(2)3/h14-16,22H,2,8-13H2,1,3-7H3.
What are the key properties of [3-acetyloxy-2-(1,3-dimethyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenyl] acetate?
[3-acetyloxy-2-(1,3-dimethyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenyl] acetate has a molecular weight of 412.57 g/mol, XLogP of 6.46, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-acetyloxy-2-(1,3-dimethyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenyl] acetate is sourced from PubChem (CID 91563625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).