C26H36O4 — CID 91563625
[3-acetyloxy-2-(1,3-dimethyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenyl] acetate (PubChem CID 91563625) has the molecular formula C26H36O4 and a molecular weight of 412.57 g/mol. Its IUPAC name is [3-acetyloxy-2-(1,3-dimethyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenyl] acetate.
| Compound Name | [3-acetyloxy-2-(1,3-dimethyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenyl] acetate |
|---|---|
| PubChem CID | 91563625 |
| Molecular Formula | C26H36O4 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | [3-acetyloxy-2-(1,3-dimethyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenyl] acetate |
| SMILES | C=C(C)C1CCC(C)=CC1(C)c1c(OC(C)=O)cc(CCCCC)cc1OC(C)=O |
| InChI | InChI=1S/C26H36O4/c1-8-9-10-11-21-14-23(29-19(5)27)25(24(15-21)30-20(6)28)26(7)16-18(4)12-13-22(26)17(2)3/h14-16,22H,2,8-13H2,1,3-7H3 |
| InChIKey | WRLIAUBYZAJTOA-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|