C13H13ClN4O2 — CID 91566398
(2S)-3-(4-aminophenyl)-2-[(3-chloropyrazin-2-yl)amino]propanoic acid (PubChem CID 91566398) has the molecular formula C13H13ClN4O2 and a molecular weight of 292.73 g/mol. Its IUPAC name is (2S)-3-(4-aminophenyl)-2-[(3-chloropyrazin-2-yl)amino]propanoic acid.
| Compound Name | (2S)-3-(4-aminophenyl)-2-[(3-chloropyrazin-2-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 91566398 |
| Molecular Formula | C13H13ClN4O2 |
| Molecular Weight | 292.73 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | (2S)-3-(4-aminophenyl)-2-[(3-chloropyrazin-2-yl)amino]propanoic acid |
| SMILES | Nc1ccc(C[C@H](Nc2nccnc2Cl)C(=O)O)cc1 |
| InChI | InChI=1S/C13H13ClN4O2/c14-11-12(17-6-5-16-11)18-10(13(19)20)7-8-1-3-9(15)4-2-8/h1-6,10H,7,15H2,(H,17,18)(H,19,20)/t10-/m0/s1 |
| InChIKey | PYQBLXJTHWFKRQ-JTQLQIEISA-N |
| XLogP | 1.82 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.73 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|