C13H20N4S — CID 91567190
N'-[4-(4,5-dihydrothiadiazol-4-yl)phenyl]pentane-1,5-diamine (PubChem CID 91567190) has the molecular formula C13H20N4S and a molecular weight of 264.40 g/mol. Its IUPAC name is N'-[4-(4,5-dihydrothiadiazol-4-yl)phenyl]pentane-1,5-diamine.
| Compound Name | N'-[4-(4,5-dihydrothiadiazol-4-yl)phenyl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 91567190 |
| Molecular Formula | C13H20N4S |
| Molecular Weight | 264.40 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | N'-[4-(4,5-dihydrothiadiazol-4-yl)phenyl]pentane-1,5-diamine |
| SMILES | NCCCCCNc1ccc(C2CSN=N2)cc1 |
| InChI | InChI=1S/C13H20N4S/c14-8-2-1-3-9-15-12-6-4-11(5-7-12)13-10-18-17-16-13/h4-7,13,15H,1-3,8-10,14H2 |
| InChIKey | STMBDDNODXPRBR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|