About 4,7,9,12-tetramethyltetracyclo[7.3.1.14,12.02,7]tetradecane
4,7,9,12-tetramethyltetracyclo[7.3.1.14,12.02,7]tetradecane (PubChem CID 91570284) has the molecular formula C18H30
and a molecular weight of 246.44 g/mol. Its IUPAC name is 4,7,9,12-tetramethyltetracyclo[7.3.1.14,12.02,7]tetradecane.
Analyze 4,7,9,12-tetramethyltetracyclo[7.3.1.14,12.02,7]tetradecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7,9,12-tetramethyltetracyclo[7.3.1.14,12.02,7]tetradecane?
The IUPAC name of 4,7,9,12-tetramethyltetracyclo[7.3.1.14,12.02,7]tetradecane (CID 91570284) is 4,7,9,12-tetramethyltetracyclo[7.3.1.14,12.02,7]tetradecane.
What is the SMILES notation for 4,7,9,12-tetramethyltetracyclo[7.3.1.14,12.02,7]tetradecane?
The canonical SMILES for 4,7,9,12-tetramethyltetracyclo[7.3.1.14,12.02,7]tetradecane is CC12CCC3(C)CC4(C)CCC(C)(C1)C(C4)C3C2.
What is the InChIKey of 4,7,9,12-tetramethyltetracyclo[7.3.1.14,12.02,7]tetradecane?
The InChIKey is GOZXXCWKQAHTSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30/c1-15-5-7-18(4)12-16(2)6-8-17(3,11-15)14(10-16)13(18)9-15/h13-14H,5-12H2,1-4H3.
What are the key properties of 4,7,9,12-tetramethyltetracyclo[7.3.1.14,12.02,7]tetradecane?
4,7,9,12-tetramethyltetracyclo[7.3.1.14,12.02,7]tetradecane has a molecular weight of 246.44 g/mol, XLogP of 5.42, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7,9,12-tetramethyltetracyclo[7.3.1.14,12.02,7]tetradecane is sourced from PubChem (CID 91570284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).