C19H18BrI3O6S — CID 91572079
[4-bromo-2-[2-(4-methylphenyl)sulfonyloxyacetyl]phenyl] acetate;1,1,1-triiodoethane (PubChem CID 91572079) has the molecular formula C19H18BrI3O6S and a molecular weight of 835.03 g/mol. Its IUPAC name is [4-bromo-2-[2-(4-methylphenyl)sulfonyloxyacetyl]phenyl] acetate;1,1,1-triiodoethane.
| Compound Name | [4-bromo-2-[2-(4-methylphenyl)sulfonyloxyacetyl]phenyl] acetate;1,1,1-triiodoethane |
|---|---|
| PubChem CID | 91572079 |
| Molecular Formula | C19H18BrI3O6S |
| Molecular Weight | 835.03 g/mol |
| Exact Mass | 833.71 |
| IUPAC Name | [4-bromo-2-[2-(4-methylphenyl)sulfonyloxyacetyl]phenyl] acetate;1,1,1-triiodoethane |
| SMILES | CC(=O)Oc1ccc(Br)cc1C(=O)COS(=O)(=O)c1ccc(C)cc1.CC(I)(I)I |
| InChI | InChI=1S/C17H15BrO6S.C2H3I3/c1-11-3-6-14(7-4-11)25(21,22)23-10-16(20)15-9-13(18)5-8-17(15)24-12(2)19;1-2(3,4)5/h3-9H,10H2,1-2H3;1H3 |
| InChIKey | CSENCCGDIXGXBA-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.03 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|