C13H13O9P — CID 91572755
[(5R)-2,4-dioxo-5-[(4S)-2-phenyl-1,3-dioxolan-4-yl]oxolan-3-yl] dihydrogen phosphate (PubChem CID 91572755) has the molecular formula C13H13O9P and a molecular weight of 344.21 g/mol. Its IUPAC name is [(5R)-2,4-dioxo-5-[(4S)-2-phenyl-1,3-dioxolan-4-yl]oxolan-3-yl] dihydrogen phosphate.
| Compound Name | [(5R)-2,4-dioxo-5-[(4S)-2-phenyl-1,3-dioxolan-4-yl]oxolan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 91572755 |
| Molecular Formula | C13H13O9P |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | [(5R)-2,4-dioxo-5-[(4S)-2-phenyl-1,3-dioxolan-4-yl]oxolan-3-yl] dihydrogen phosphate |
| SMILES | O=C1O[C@H]([C@@H]2COC(c3ccccc3)O2)C(=O)C1OP(=O)(O)O |
| InChI | InChI=1S/C13H13O9P/c14-9-10(21-12(15)11(9)22-23(16,17)18)8-6-19-13(20-8)7-4-2-1-3-5-7/h1-5,8,10-11,13H,6H2,(H2,16,17,18)/t8-,10+,11?,13?/m0/s1 |
| InChIKey | SPZZAZXRRSDAAY-MWYSWZHKSA-N |
| XLogP | 0.07 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|