C9H11FO3 — CID 91574330
(2R,3R,5S)-2-(4-fluorobut-1-en-3-ynyl)-5-methyloxolane-3,4-diol (PubChem CID 91574330) has the molecular formula C9H11FO3 and a molecular weight of 186.18 g/mol. Its IUPAC name is (2R,3R,5S)-2-(4-fluorobut-1-en-3-ynyl)-5-methyloxolane-3,4-diol.
| Compound Name | (2R,3R,5S)-2-(4-fluorobut-1-en-3-ynyl)-5-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 91574330 |
| Molecular Formula | C9H11FO3 |
| Molecular Weight | 186.18 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | (2R,3R,5S)-2-(4-fluorobut-1-en-3-ynyl)-5-methyloxolane-3,4-diol |
| SMILES | C[C@@H]1O[C@H](C=CC#CF)[C@H](O)C1O |
| InChI | InChI=1S/C9H11FO3/c1-6-8(11)9(12)7(13-6)4-2-3-5-10/h2,4,6-9,11-12H,1H3/t6-,7+,8?,9-/m0/s1 |
| InChIKey | ONTRNQYEQZFMAS-CUIKDFOKSA-N |
| XLogP | -0.02 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.18 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|