C24H24N2 — CID 91585435
7-cyclohexa-1,5-dien-1-yl-4-cyclohexa-2,4-dien-1-yl-1,2,10a,10b-tetrahydro-1,10-phenanthroline (PubChem CID 91585435) has the molecular formula C24H24N2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 7-cyclohexa-1,5-dien-1-yl-4-cyclohexa-2,4-dien-1-yl-1,2,10a,10b-tetrahydro-1,10-phenanthroline.
| Compound Name | 7-cyclohexa-1,5-dien-1-yl-4-cyclohexa-2,4-dien-1-yl-1,2,10a,10b-tetrahydro-1,10-phenanthroline |
|---|---|
| PubChem CID | 91585435 |
| Molecular Formula | C24H24N2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 7-cyclohexa-1,5-dien-1-yl-4-cyclohexa-2,4-dien-1-yl-1,2,10a,10b-tetrahydro-1,10-phenanthroline |
| SMILES | C1=CCC(C2=CCNC3C2=CC=C2C(C4=CCCC=C4)=CC=NC23)C=C1 |
| InChI | InChI=1S/C24H24N2/c1-3-7-17(8-4-1)19-13-15-25-23-21(19)11-12-22-20(14-16-26-24(22)23)18-9-5-2-6-10-18/h1,3-5,7,9-14,16-17,23-25H,2,6,8,15H2 |
| InChIKey | OANKQSFHRNGDMT-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |