C19H26N2O — CID 91592805
4-[(3S)-3,5-dimethyl-8-nitrosonona-1,4,6-trien-2-yl]-N,N-dimethylaniline (PubChem CID 91592805) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is 4-[(3S)-3,5-dimethyl-8-nitrosonona-1,4,6-trien-2-yl]-N,N-dimethylaniline.
| Compound Name | 4-[(3S)-3,5-dimethyl-8-nitrosonona-1,4,6-trien-2-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 91592805 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 4-[(3S)-3,5-dimethyl-8-nitrosonona-1,4,6-trien-2-yl]-N,N-dimethylaniline |
| SMILES | C=C(c1ccc(N(C)C)cc1)[C@@H](C)C=C(C)C=CC(C)N=O |
| InChI | InChI=1S/C19H26N2O/c1-14(7-8-16(3)20-22)13-15(2)17(4)18-9-11-19(12-10-18)21(5)6/h7-13,15-16H,4H2,1-3,5-6H3/t15-,16?/m0/s1 |
| InChIKey | XYHQYTQISLYWMV-VYRBHSGPSA-N |
| XLogP | 5.06 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|