C31H32N2O5 — CID 91592959
2-[2-methyl-4-[1-[[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methoxy]-3-phenylaziridin-2-yl]phenoxy]butanoic acid (PubChem CID 91592959) has the molecular formula C31H32N2O5 and a molecular weight of 512.61 g/mol. Its IUPAC name is 2-[2-methyl-4-[1-[[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methoxy]-3-phenylaziridin-2-yl]phenoxy]butanoic acid.
| Compound Name | 2-[2-methyl-4-[1-[[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methoxy]-3-phenylaziridin-2-yl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 91592959 |
| Molecular Formula | C31H32N2O5 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | 2-[2-methyl-4-[1-[[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methoxy]-3-phenylaziridin-2-yl]phenoxy]butanoic acid |
| SMILES | CCC(Oc1ccc(C2C(c3ccccc3)N2OCc2nc(-c3ccc(C)cc3)oc2C)cc1C)C(=O)O |
| InChI | InChI=1S/C31H32N2O5/c1-5-26(31(34)35)38-27-16-15-24(17-20(27)3)29-28(22-9-7-6-8-10-22)33(29)36-18-25-21(4)37-30(32-25)23-13-11-19(2)12-14-23/h6-17,26,28-29H,5,18H2,1-4H3,(H,34,35) |
| InChIKey | SNEQRGHOTLYJBS-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 84.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|