C31H40N+ — CID 91593172
6,6,7-triethyl-2-hexyl-3-phenyl-7H-benzo[a]quinolizin-5-ium (PubChem CID 91593172) has the molecular formula C31H40N+ and a molecular weight of 426.67 g/mol. Its IUPAC name is 6,6,7-triethyl-2-hexyl-3-phenyl-7H-benzo[a]quinolizin-5-ium.
| Compound Name | 6,6,7-triethyl-2-hexyl-3-phenyl-7H-benzo[a]quinolizin-5-ium |
|---|---|
| PubChem CID | 91593172 |
| Molecular Formula | C31H40N+ |
| Molecular Weight | 426.67 g/mol |
| Exact Mass | 426.32 |
| IUPAC Name | 6,6,7-triethyl-2-hexyl-3-phenyl-7H-benzo[a]quinolizin-5-ium |
| SMILES | CCCCCCc1cc2[n+](cc1-c1ccccc1)C(CC)(CC)C(CC)c1ccccc1-2 |
| InChI | InChI=1S/C31H40N/c1-5-9-10-12-19-25-22-30-27-21-16-15-20-26(27)29(6-2)31(7-3,8-4)32(30)23-28(25)24-17-13-11-14-18-24/h11,13-18,20-23,29H,5-10,12,19H2,1-4H3/q+1 |
| InChIKey | LAWUCXHPIUGVTM-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.67 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|