C24H44N4S7 — CID 91595753
CID 91595753 (PubChem CID 91595753) has the molecular formula C24H44N4S7 and a molecular weight of 613.11 g/mol.
| Compound Name | CID 91595753 |
|---|---|
| PubChem CID | 91595753 |
| Molecular Formula | C24H44N4S7 |
| Molecular Weight | 613.11 g/mol |
| Exact Mass | 612.16 |
| IUPAC Name | — |
| SMILES | CC1C2CC(C(S(=S)(=S)S)C3CCC(N3)C([S-](=S)=S)C3CCC(C(C)C4CCC1N4)N3C)[NH+](C)C2 |
| InChI | InChI=1S/C24H43N4S7/c1-13-15-11-22(27(3)12-15)24(35(31,32)33)19-8-7-18(26-19)23(34(29)30)21-10-9-20(28(21)4)14(2)17-6-5-16(13)25-17/h13-26H,5-12H2,1-4H3,(H,31,32,33)/q-1/p+1 |
| InChIKey | QFJBLXSTVDXSDR-UHFFFAOYSA-O |
| XLogP | 1.08 |
| TPSA | 31.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.11 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|