C20H34O7 — CID 91597173
2-[5-(2-butan-2-yloxypropanoyloxy)-3-methyl-4-oxohexan-3-yl]oxyethyl 2-methylprop-2-enoate (PubChem CID 91597173) has the molecular formula C20H34O7 and a molecular weight of 386.49 g/mol. Its IUPAC name is 2-[5-(2-butan-2-yloxypropanoyloxy)-3-methyl-4-oxohexan-3-yl]oxyethyl 2-methylprop-2-enoate.
| Compound Name | 2-[5-(2-butan-2-yloxypropanoyloxy)-3-methyl-4-oxohexan-3-yl]oxyethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 91597173 |
| Molecular Formula | C20H34O7 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | 2-[5-(2-butan-2-yloxypropanoyloxy)-3-methyl-4-oxohexan-3-yl]oxyethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC(C)(CC)C(=O)C(C)OC(=O)C(C)OC(C)CC |
| InChI | InChI=1S/C20H34O7/c1-9-14(5)26-16(7)19(23)27-15(6)17(21)20(8,10-2)25-12-11-24-18(22)13(3)4/h14-16H,3,9-12H2,1-2,4-8H3 |
| InChIKey | URVXDXJONBZCLS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|